Difference between revisions of "Tiso gene 6106"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15368 CPD-15368] == * smiles: ** CCCCCCC(O)CC=CCCCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
(Created page with "Category:Gene == Gene Tiso_gene_6106 == * right end position: ** 2128 * transcription direction: ** NEGATIVE * left end position: ** 185 * centisome position: ** 1.287942...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15368 CPD-15368] ==
+
== Gene Tiso_gene_6106 ==
−
* smiles:
+
* right end position:
−
** CCCCCCC(O)CC=CCCCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 2128
−
* common name:
+
* transcription direction:
−
** 3-oxo-lesqueroloyl-CoA
+
** NEGATIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=NQXRRZBOZBKGIU-MHAUFEDZSA-J
+
** 185
−
* molecular weight:
+
* centisome position:
−
** 1085.989    
+
** 1.287942    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14493]]
+
* Reaction: [[PNKIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[PYRAMKIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[PYRIDOXKIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-7204]]
 +
* [[PWY-7282]]
 +
* [[PLPSAL-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2128}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657339 90657339]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCCCCCC(O)CC=CCCCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: left end position=185}}
−
{{#set: common name=3-oxo-lesqueroloyl-CoA}}
+
{{#set: centisome position=1.287942    }}
−
{{#set: inchi key=InChIKey=NQXRRZBOZBKGIU-MHAUFEDZSA-J}}
+
{{#set: reaction associated=PNKIN-RXN|PYRAMKIN-RXN|PYRIDOXKIN-RXN}}
−
{{#set: molecular weight=1085.989    }}
+
{{#set: pathway associated=PWY-7204|PWY-7282|PLPSAL-PWY}}
−
{{#set: consumed by=RXN-14493}}
+

Latest revision as of 19:54, 21 March 2018

Gene Tiso_gene_6106

  • right end position:
    • 2128
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 185
  • centisome position:
    • 1.287942
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6106&oldid=44516"