Difference between revisions of "L-PANTOATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Linear-Malto-Oligosaccharides Linear-Malto-Oligosaccharides] == * common name: ** a linear malt...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-PANTOATE L-PANTOATE] == * smiles: ** CC(C)(CO)C(C([O-])=O)O * common name: ** (R)-pantoate *...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-PANTOATE L-PANTOATE] == |
| + | * smiles: | ||
| + | ** CC(C)(CO)C(C([O-])=O)O | ||
* common name: | * common name: | ||
| − | ** | + | ** (R)-pantoate |
| + | * inchi key: | ||
| + | ** InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M | ||
| + | * molecular weight: | ||
| + | ** 147.15 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** pantoate | ||
| + | ** L-pantoate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[PANTOATE-BETA-ALANINE-LIG-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2-DEHYDROPANTOATE-REDUCT-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 470-29-1 |
| − | {{#set: | + | * DRUGBANK : DB01930 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5289105 5289105] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00522 C00522] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4451134.html 4451134] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15980 15980] | ||
| + | * BIGG : pant__R | ||
| + | {{#set: smiles=CC(C)(CO)C(C([O-])=O)O}} | ||
| + | {{#set: common name=(R)-pantoate}} | ||
| + | {{#set: inchi key=InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M}} | ||
| + | {{#set: molecular weight=147.15 }} | ||
| + | {{#set: common name=pantoate|L-pantoate}} | ||
| + | {{#set: consumed by=PANTOATE-BETA-ALANINE-LIG-RXN}} | ||
| + | {{#set: produced by=2-DEHYDROPANTOATE-REDUCT-RXN}} | ||
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite L-PANTOATE
- smiles:
- CC(C)(CO)C(C([O-])=O)O
- common name:
- (R)-pantoate
- inchi key:
- InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M
- molecular weight:
- 147.15
- Synonym(s):
- pantoate
- L-pantoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 470-29-1
- DRUGBANK : DB01930
- PUBCHEM:
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : pant__R
"CC(C)(CO)C(C([O-])=O)O" cannot be used as a page name in this wiki.
