Difference between revisions of "RXN-9985"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-4 CPD1F-4] == * smiles: ** CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1) * com...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9985 RXN-9985] == * direction: ** LEFT-TO-RIGHT * common name: ** sphingomyelinase * ec number:...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9985 RXN-9985] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
| − | ** | + | ** sphingomyelinase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/3.2.1.26 EC-3.2.1.26] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[Beta-D-Fructofuranosides]][c] '''=>''' 1 [[Glycosides]][c] '''+''' 1 [[BETA-D-FRUCTOSE]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 H2O[c] '''+''' 1 a β-D-fructofuranoside[c] '''=>''' 1 a glycoside[c] '''+''' 1 β-D-fructofuranose[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_12644]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=sphingomyelinase}} | |
| − | + | {{#set: ec number=EC-3.2.1.26}} | |
| − | + | {{#set: gene associated=Tiso_gene_12644}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:55, 21 March 2018
Contents
Reaction RXN-9985
- direction:
- LEFT-TO-RIGHT
- common name:
- sphingomyelinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 Beta-D-Fructofuranosides[c] => 1 Glycosides[c] + 1 BETA-D-FRUCTOSE[c]
- With common name(s):
- 1 H2O[c] + 1 a β-D-fructofuranoside[c] => 1 a glycoside[c] + 1 β-D-fructofuranose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_12644
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
