Difference between revisions of "LINOLEOYL-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14018 CPD-14018] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=LINOLEOYL-RXN LINOLEOYL-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14018 CPD-14018] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=LINOLEOYL-RXN LINOLEOYL-RXN] ==
−
* smiles:
+
* direction:
−
** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* common name:
+
* ec number:
−
** icosapentaenoyl-CoA
+
** [http://enzyme.expasy.org/EC/3.1.2 EC-3.1.2]
−
* inchi key:
+
−
** InChIKey=JWZLRYCDDXHXDL-LCMHIRPZSA-J
+
−
* molecular weight:
+
−
** 1047.943   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (5Z,8Z,11Z,14Z,17Z)-icosapentaenoyl-CoA
 
−
** (5Z,8Z,11Z,14Z,17Z)-eicosapentaenoyl-CoA
 
−
** (5Z,8Z,11Z,14Z,17Z)-eicosa-5,8,11,14,17-pentaenoyl-CoA
 
−
** (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl-CoA
 
−
** eicosapentaenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-13442]]
+
* With identifiers:
−
* [[RXN-13430]]
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-18]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[LINOLEIC_ACID]][c] '''+''' 1 [[CO-A]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN-12978]]
+
** 1 H2O[c] '''+''' 1 linoleoyl-CoA[c] '''=>''' 1 H+[c] '''+''' 1 linoleate[c] '''+''' 1 coenzyme A[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_801]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_7477]]
 +
** Source: [[orthology-athaliana]]
 +
== Pathways  ==
 +
* [[PWY-6917]], vernolate biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6917 PWY-6917]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581014 71581014]
+
** [http://www.genome.jp/dbget-bin/www_bget?R08177 R08177]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73862 73862]
+
{{#set: ec number=EC-3.1.2}}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: gene associated=Tiso_gene_801|Tiso_gene_7477}}
−
{{#set: common name=icosapentaenoyl-CoA}}
+
{{#set: in pathway=PWY-6917}}
−
{{#set: inchi key=InChIKey=JWZLRYCDDXHXDL-LCMHIRPZSA-J}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=1047.943    }}
+
{{#set: reconstruction source=orthology-athaliana|orthology-creinhardtii}}
−
{{#set: common name=(5Z,8Z,11Z,14Z,17Z)-icosapentaenoyl-CoA|(5Z,8Z,11Z,14Z,17Z)-eicosapentaenoyl-CoA|(5Z,8Z,11Z,14Z,17Z)-eicosa-5,8,11,14,17-pentaenoyl-CoA|(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl-CoA|eicosapentaenoyl-CoA}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: consumed by=RXN-13442|RXN-13430}}
+
−
{{#set: produced by=RXN-12978}}
+

Latest revision as of 19:55, 21 March 2018

Reaction LINOLEOYL-RXN

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 linoleoyl-CoA[c] => 1 H+[c] + 1 linoleate[c] + 1 coenzyme A[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6917, vernolate biosynthesis III: PWY-6917
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=LINOLEOYL-RXN&oldid=44596"