Difference between revisions of "RXN-12383"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17347 CPD-17347] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12383 RXN-12383] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.3...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17347 CPD-17347] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12383 RXN-12383] ==
* smiles:
+
* direction:
** CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
* common name:
+
* ec number:
** (3R)-hydroxy-(11Z,14Z)-icosa-11,14-dienoyl-CoA
+
** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1]
* inchi key:
+
** InChIKey=MNTSLNSVZACNCX-JPDDAYGWSA-J
+
* molecular weight:
+
** 1069.99   
+
 
* Synonym(s):
 
* Synonym(s):
** (3R)-hydroxy-20:2Δ11,14
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-16096]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 2 [[DIACYLGLYCEROL]][c] '''<=>''' 1 [[CPD-409]][c] '''+''' 1 [[Triacylglycerols]][c]
* [[RXN-16095]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 2 a 1,2-diacyl-sn-glycerol[c] '''<=>''' 1 a 2-acylglycerol[c] '''+''' 1 a triacyl-sn-glycerol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[TRIGLSYN-PWY]], diacylglycerol and triacylglycerol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=TRIGLSYN-PWY TRIGLSYN-PWY]
 +
** '''7''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193805 72193805]
+
{{#set: ec number=EC-2.3.1}}
* CHEBI:
+
{{#set: in pathway=TRIGLSYN-PWY}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76408 76408]
+
{{#set: reconstruction category=annotation}}
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
{{#set: common name=(3R)-hydroxy-(11Z,14Z)-icosa-11,14-dienoyl-CoA}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: inchi key=InChIKey=MNTSLNSVZACNCX-JPDDAYGWSA-J}}
+
{{#set: molecular weight=1069.99    }}
+
{{#set: common name=(3R)-hydroxy-20:2&Delta;11,14}}
+
{{#set: consumed by=RXN-16096}}
+
{{#set: produced by=RXN-16095}}
+

Latest revision as of 19:55, 21 March 2018

Reaction RXN-12383

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 2 a 1,2-diacyl-sn-glycerol[c] <=> 1 a 2-acylglycerol[c] + 1 a triacyl-sn-glycerol[c]

Genes associated with this reaction

Pathways

  • TRIGLSYN-PWY, diacylglycerol and triacylglycerol biosynthesis: TRIGLSYN-PWY
    • 7 reactions found over 7 reactions in the full pathway

Reconstruction information

External links