|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1134 RXN0-1134] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-369 CPD-369] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C(C(C(C(C(O)CO)O)O)O)O |
| + | * inchi key: |
| + | ** InChIKey=FBPFZTCFMRRESA-UNTFVMJOSA-N |
| * common name: | | * common name: |
− | ** pyruvate_dehydrogenase_e1_component_subunit_alpha-_mitochondrial | + | ** L-iditol |
− | ** dihydrolipoamide_acetyltransferase | + | * molecular weight: |
− | ** ORF
| + | ** 182.173 |
− | * ec number:
| + | |
− | ** [http://enzyme.expasy.org/EC/1.2.4.1 EC-1.2.4.1] | + | |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[Pyruvate-dehydrogenase-lipoate]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[PYRUVATE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[Pyruvate-dehydrogenase-acetylDHlipoyl]][c]
| + | == Reaction(s) of unknown directionality == |
− | * With common name(s):
| + | * [[L-IDITOL-2-DEHYDROGENASE-RXN]] |
− | ** 1 a [pyruvate dehydrogenase E2 protein] N6-lipoyl-L-lysine[c] '''+''' 1 H+[c] '''+''' 1 pyruvate[c] '''=>''' 1 CO2[c] '''+''' 1 a [pyruvate dehydrogenase E2 protein] N6-S-acetyldihydrolipoyl-L-lysine[c]
| + | |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_17539]]
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_2693]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_7519]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_6983]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_2515]]
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | == Pathways == | + | |
− | * [[PYRUVDEHYD-PWY]], pyruvate decarboxylation to acetyl CoA: [http://metacyc.org/META/NEW-IMAGE?object=PYRUVDEHYD-PWY PYRUVDEHYD-PWY] | + | |
− | ** '''3''' reactions found over '''3''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[esiliculosus]]
| + | |
− | * [[manual]]:
| + | |
− | ** [[primary_network]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[experimental_annotation]]
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * LIGAND-RXN: | + | * CAS : 488-45-9 |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R01699 R01699]
| + | * PUBCHEM: |
− | * UNIPROT: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460044 5460044] |
− | ** [http://www.uniprot.org/uniprot/P06959 P06959] | + | * HMDB : HMDB11632 |
− | ** [http://www.uniprot.org/uniprot/P26267 P26267]
| + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P35485 P35485]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01507 C01507] |
− | ** [http://www.uniprot.org/uniprot/Q59097 Q59097] | + | * CHEMSPIDER: |
− | ** [http://www.uniprot.org/uniprot/Q9N1X8 Q9N1X8] | + | ** [http://www.chemspider.com/Chemical-Structure.4573729.html 4573729] |
− | ** [http://www.uniprot.org/uniprot/P45119 P45119] | + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P11966 P11966] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18202 18202] |
− | ** [http://www.uniprot.org/uniprot/P35488 P35488] | + | * METABOLIGHTS : MTBLC18202 |
− | ** [http://www.uniprot.org/uniprot/P47515 P47515]
| + | {{#set: smiles=C(C(C(C(C(O)CO)O)O)O)O}} |
− | ** [http://www.uniprot.org/uniprot/P21882 P21882] | + | {{#set: inchi key=InChIKey=FBPFZTCFMRRESA-UNTFVMJOSA-N}} |
− | ** [http://www.uniprot.org/uniprot/P47516 P47516] | + | {{#set: common name=L-iditol}} |
− | ** [http://www.uniprot.org/uniprot/P21881 P21881]
| + | {{#set: molecular weight=182.173 }} |
− | ** [http://www.uniprot.org/uniprot/P21873 P21873]
| + | {{#set: consumed or produced by=L-IDITOL-2-DEHYDROGENASE-RXN}} |
− | ** [http://www.uniprot.org/uniprot/P16387 P16387] | + | |
− | ** [http://www.uniprot.org/uniprot/P0AFG8 P0AFG8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08559 P08559]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11177 P11177]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29803 P29803]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29804 P29804]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26284 P26284]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JU08 Q9JU08]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CJD6 Q9CJD6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JU07 Q9JU07]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CJD5 Q9CJD5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q09171 Q09171]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52901 P52901]
| + | |
− | ** [http://www.uniprot.org/uniprot/P79931 P79931]
| + | |
− | ** [http://www.uniprot.org/uniprot/P79932 P79932]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9D051 Q9D051]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10801 P10801]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21874 P21874]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49432 P49432]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59820 Q59820]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35486 P35486]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35487 P35487]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q06437 Q06437]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32473 P32473]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59107 Q59107]
| + | |
− | ** [http://www.uniprot.org/uniprot/P73405 P73405]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49109 Q49109]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48685 O48685]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52902 P52902]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52904 P52904]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52903 P52903]
| + | |
− | ** [http://www.uniprot.org/uniprot/O66112 O66112]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Y8I5 Q9Y8I5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Y8I6 Q9Y8I6]
| + | |
− | ** [http://www.uniprot.org/uniprot/O69478 O69478]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10802 P10802]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=pyruvate_dehydrogenase_e1_component_subunit_alpha-_mitochondrial}} | + | |
− | {{#set: common name=dihydrolipoamide_acetyltransferase}} | + | |
− | {{#set: common name=ORF}} | + | |
− | {{#set: ec number=EC-1.2.4.1}} | + | |
− | {{#set: gene associated=Tiso_gene_17539|Tiso_gene_2693|Tiso_gene_7519|Tiso_gene_6983|Tiso_gene_2515}}
| + | |
− | {{#set: in pathway=PYRUVDEHYD-PWY}}
| + | |
− | {{#set: reconstruction category=orthology}}
| + | |
− | {{#set: reconstruction tool=pantograph}}
| + | |
− | {{#set: reconstruction source=esiliculosus}}
| + | |
− | {{#set: reconstruction category=manual}}
| + | |
− | {{#set: reconstruction source=primary_network}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
| + | |