Difference between revisions of "3Prime-OH-Terminated-RNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6792 PWY-6792] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6792 PWY-6792] ==
* smiles:
+
* taxonomic range:
** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N
+
 
* common name:
 
* common name:
** cycloartenol
+
** scopoletin biosynthesis
* molecular weight:
+
** 426.724   
+
 
* Synonym(s):
 
* Synonym(s):
** 9β,19-cyclo-24-lanosten-3β-ol
 
** cycloart-24(25)-enol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-4021]]
+
* '''1''' reaction(s) found
== Reaction(s) known to produce the compound ==
+
** [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
* [[CYCLOARTENOL-SYNTHASE-RXN]]
+
== Reaction(s) not found ==
== Reaction(s) of unknown directionality ==
+
* '''2''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12350 RXN-12350]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12349 RXN-12349]
 
== External links  ==
 
== External links  ==
* CAS : 469-38-5
+
{{#set: taxonomic range=TAX-33090}}
* PUBCHEM:
+
{{#set: common name=scopoletin biosynthesis}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44434254 44434254]
+
{{#set: reaction found=1}}
* CHEBI:
+
{{#set: reaction not found=2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17030 17030]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01902 C01902]
+
* HMDB : HMDB36591
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
+
{{#set: inchi key=InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N}}
+
{{#set: common name=cycloartenol}}
+
{{#set: molecular weight=426.724    }}
+
{{#set: common name=9β,19-cyclo-24-lanosten-3β-ol|cycloart-24(25)-enol}}
+
{{#set: consumed by=RXN-4021}}
+
{{#set: produced by=CYCLOARTENOL-SYNTHASE-RXN}}
+

Revision as of 16:27, 10 January 2018

Pathway PWY-6792

  • taxonomic range:
  • common name:
    • scopoletin biosynthesis
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

External links