Difference between revisions of "PWY-7376"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))...")
 
(Created page with "Category:Gene == Gene Tiso_gene_11866 == * left end position: ** 1685 * transcription direction: ** NEGATIVE * right end position: ** 4128 * centisome position: ** 22.5689...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] ==
+
== Gene Tiso_gene_11866 ==
−
* smiles:
+
* left end position:
−
** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))
+
** 1685
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** delphinidin 3,5-di-O-β-D-glucoside
+
** 4128
−
* molecular weight:
+
* centisome position:
−
** 626.524    
+
** 22.56898    
 
* Synonym(s):
 
* Synonym(s):
−
** delphinidin-3,5-diglucoside
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-8988]]
−
* [[RXN-8228]]
+
** [[pantograph]]-[[esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* [[SUCCCOASYN-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[synechocystis]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[SUCL_gdp_m]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-5913]]
 +
* [[P42-PWY]]
 +
* [[PWY-7384]]
 +
* [[PWY-5392]]
 +
* [[TCA]]
 +
* [[P23-PWY]]
 +
* [[PWY-6969]]
 +
* [[PWY-6728]]
 +
* [[PWY-5749]]
 +
* [[PWY-5538]]
 +
* [[PWY-5537]]
 +
* [[PWY66-398]]
 +
* [[PWY-5690]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1685}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201902 25201902]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=4128}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77838 77838]
+
{{#set: centisome position=22.56898   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=RXN-8988|SUCCCOASYN-RXN|SUCCINATE--COA-LIGASE-GDP-FORMING-RXN|SUCL_gdp_m}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16312 C16312]
+
{{#set: pathway associated=PWY-5913|P42-PWY|PWY-7384|PWY-5392|TCA|P23-PWY|PWY-6969|PWY-6728|PWY-5749|PWY-5538|PWY-5537|PWY66-398|PWY-5690}}
−
* HMDB : HMDB30693
+
−
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))}}
+
−
{{#set: inchi key=InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N}}
+
−
{{#set: common name=delphinidin 3,5-di-O-β-D-glucoside}}
+
−
{{#set: molecular weight=626.524   }}
+
−
{{#set: common name=delphinidin-3,5-diglucoside}}
+
−
{{#set: produced by=RXN-8228}}
+

Revision as of 15:38, 10 January 2018

Gene Tiso_gene_11866

  • left end position:
    • 1685
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4128
  • centisome position:
    • 22.56898
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-7376&oldid=9838"