Difference between revisions of "RXN-14388"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11878 CPD-11878] == * smiles: ** C(O)C(O)C1(C=CC(O)=C(O)C=1) * common name: ** 3,4-dihydrox...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14388 RXN-14388] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14388 RXN-14388] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[CD-SP-2Fe2S-Complex]][c] '''+''' 1 [[FeS-Cluster-Co-Chaperones]][c] '''=>''' 1 [[L-Cysteine-Desulfurases]][c] '''+''' 1 [[Co-chaperone-SP-2Fe2S-Complex]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a [cysteine desulfurase]-[scaffold protein-(2Fe-2S)] complex[c] '''+''' 1 an [Fe-S cluster biosynthesis co-chaperone][c] '''=>''' 1 an [L-cysteine desulfurase][c] '''+''' 1 a [co-chaperone]-[scaffold protein-(2Fe-2S)] complex[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-7250]], [2Fe-2S] iron-sulfur cluster biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7250 PWY-7250] | ||
+ | ** '''10''' reactions found over '''10''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: in pathway=PWY-7250}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:56, 21 March 2018
Contents
Reaction RXN-14388
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CD-SP-2Fe2S-Complex[c] + 1 FeS-Cluster-Co-Chaperones[c] => 1 L-Cysteine-Desulfurases[c] + 1 Co-chaperone-SP-2Fe2S-Complex[c]
- With common name(s):
- 1 a [cysteine desulfurase]-[scaffold protein-(2Fe-2S)] complex[c] + 1 an [Fe-S cluster biosynthesis co-chaperone][c] => 1 an [L-cysteine desulfurase][c] + 1 a [co-chaperone]-[scaffold protein-(2Fe-2S)] complex[c]
Genes associated with this reaction
Pathways
- PWY-7250, [2Fe-2S] iron-sulfur cluster biosynthesis: PWY-7250
- 10 reactions found over 10 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation