Difference between revisions of "S-PRENYL-L-CYSTEINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=G6PB_pi_th G6PB_pi_th] == * direction: ** REVERSIBLE * common name: ** beta-glucose 6-phosphate:pi...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] == * smiles: ** CC(C)=CCSCC([N+])C(=O)[O-] * common na...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=G6PB_pi_th G6PB_pi_th] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(C)=CCSCC([N+])C(=O)[O-]
 
* common name:
 
* common name:
−
** beta-glucose 6-phosphate:pi antiporter, chloroplast
+
** S-prenyl-L-cysteine
 +
* inchi key:
 +
** InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N
 +
* molecular weight:
 +
** 189.272   
 
* Synonym(s):
 
* Synonym(s):
 +
** prenyl-L-cysteine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[1.8.3.5-RXN]]
−
** 1.0 [[GLC-6-P]][c] '''+''' 1.0 [[Pi]][h] '''<=>''' 1.0 [[GLC-6-P]][h] '''+''' 1.0 [[Pi]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 &beta;-D-glucose 6-phosphate[c] '''+''' 1.0 phosphate[h] '''<=>''' 1.0 &beta;-D-glucose 6-phosphate[h] '''+''' 1.0 phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_5890]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
* Gene: [[Tiso_gene_17661]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
* Gene: [[Tiso_gene_6426]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=beta-glucose 6-phosphate:pi antiporter, chloroplast}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200435 25200435]
−
{{#set: gene associated=Tiso_gene_5890|Tiso_gene_17661|Tiso_gene_6426}}
+
* HMDB : HMDB12286
−
{{#set: in pathway=}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47914 47914]
−
{{#set: reconstruction source=orthology-creinhardtii}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06751 C06751]
 +
{{#set: smiles=CC(C)=CCSCC([N+])C(=O)[O-]}}
 +
{{#set: common name=S-prenyl-L-cysteine}}
 +
{{#set: inchi key=InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N}}
 +
{{#set: molecular weight=189.272    }}
 +
{{#set: common name=prenyl-L-cysteine}}
 +
{{#set: consumed by=1.8.3.5-RXN}}

Latest revision as of 19:56, 21 March 2018

Metabolite S-PRENYL-L-CYSTEINE

  • smiles:
    • CC(C)=CCSCC([N+])C(=O)[O-]
  • common name:
    • S-prenyl-L-cysteine
  • inchi key:
    • InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N
  • molecular weight:
    • 189.272
  • Synonym(s):
    • prenyl-L-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCSCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=S-PRENYL-L-CYSTEINE&oldid=44769"