Difference between revisions of "Protein-Histidines"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] == * smiles: ** CC(C)=CCSCC([N+])C(=O)[O-] * common na...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Histidines Protein-Histidines] == * common name: ** a [protein]-L-histidine * Synonym(s...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Histidines Protein-Histidines] == |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a [protein]-L-histidine |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a peptidyl L-histidine |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.7.13.3-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-15512]] | ||
+ | * [[RXN-15509]] | ||
+ | * [[RXN-15510]] | ||
+ | * [[RXN-15511]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a [protein]-L-histidine}} | |
− | + | {{#set: common name=a peptidyl L-histidine}} | |
− | + | {{#set: consumed by=2.7.13.3-RXN}} | |
− | + | {{#set: reversible reaction associated=RXN-15512|RXN-15509|RXN-15510|RXN-15511}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:57, 21 March 2018
Contents
Metabolite Protein-Histidines
- common name:
- a [protein]-L-histidine
- Synonym(s):
- a peptidyl L-histidine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [protein]-L-histidine" cannot be used as a page name in this wiki.