Difference between revisions of "CPD-10806"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_9613 == * right end position: ** 12073 * transcription direction: ** POSITIVE * left end position: ** 9624 * centisome position: ** 78.1168...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10806 CPD-10806] == * smiles: ** CCCCCC(O)[CH]=CC=O * common name: ** 4-hydroxy-2-nonenal *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10806 CPD-10806] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCC(O)[CH]=CC=O |
− | * | + | * common name: |
− | ** | + | ** 4-hydroxy-2-nonenal |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=JVJFIQYAHPMBBX-FNORWQNLSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 156.224 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 4HNE | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-13673]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283344 5283344] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4446465.html 4446465] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32585 32585] |
+ | * METABOLIGHTS : MTBLC32585 | ||
+ | * HMDB : HMDB04362 | ||
+ | {{#set: smiles=CCCCCC(O)[CH]=CC=O}} | ||
+ | {{#set: common name=4-hydroxy-2-nonenal}} | ||
+ | {{#set: inchi key=InChIKey=JVJFIQYAHPMBBX-FNORWQNLSA-N}} | ||
+ | {{#set: molecular weight=156.224 }} | ||
+ | {{#set: common name=4HNE}} | ||
+ | {{#set: consumed by=RXN-13673}} |
Latest revision as of 19:57, 21 March 2018
Contents
Metabolite CPD-10806
- smiles:
- CCCCCC(O)[CH]=CC=O
- common name:
- 4-hydroxy-2-nonenal
- inchi key:
- InChIKey=JVJFIQYAHPMBBX-FNORWQNLSA-N
- molecular weight:
- 156.224
- Synonym(s):
- 4HNE
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC(O)[CH]=CC=O" cannot be used as a page name in this wiki.