Difference between revisions of "CPD-12321"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8630 RXN-8630] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12321 CPD-12321] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC=CC=C(CCC=C(CCC=C(CCC=C(C)...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8630 RXN-8630] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12321 CPD-12321] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1]
+
** 15-cis-phytoene
 +
* inchi key:
 +
** InChIKey=YVLPJIGOMTXXLP-BHLJUDRVSA-N
 +
* molecular weight:
 +
** 544.946   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-12243]]
−
** 1 [[ACETONE]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[ACETOL]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXNARA-8002]]
−
** 1 acetone[c] '''+''' 1 a reduced [NADPH-hemoprotein reductase][c] '''+''' 1 oxygen[c] '''=>''' 1 an oxidized [NADPH-hemoprotein reductase][c] '''+''' 1 H2O[c] '''+''' 1 acetol[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[RXN-13323]]
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_1035]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-7466]], acetone degradation III (to propane-1,2-diol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7466 PWY-7466]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-5451]], acetone degradation I (to methylglyoxal): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5451 PWY-5451]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-1.14.14.1}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05421 C05421]
−
{{#set: gene associated=Tiso_gene_1035}}
+
* CHEMSPIDER:
−
{{#set: in pathway=PWY-7466|PWY-5451}}
+
** [http://www.chemspider.com/Chemical-Structure.8138988.html 8138988]
−
{{#set: reconstruction category=orthology}}
+
* CHEBI:
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27787 27787]
−
{{#set: reconstruction tool=pantograph}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9963391 9963391]
 +
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C}}
 +
{{#set: common name=15-cis-phytoene}}
 +
{{#set: inchi key=InChIKey=YVLPJIGOMTXXLP-BHLJUDRVSA-N}}
 +
{{#set: molecular weight=544.946    }}
 +
{{#set: consumed by=RXN-12243}}
 +
{{#set: produced by=RXNARA-8002}}
 +
{{#set: reversible reaction associated=RXN-13323}}

Latest revision as of 20:57, 21 March 2018

Metabolite CPD-12321

  • smiles:
    • CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C
  • common name:
    • 15-cis-phytoene
  • inchi key:
    • InChIKey=YVLPJIGOMTXXLP-BHLJUDRVSA-N
  • molecular weight:
    • 544.946
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-12321&oldid=44870"