Difference between revisions of "UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18337 == * right end position: ** 2858 * transcription direction: ** NEGATIVE * left end position: ** 918 * centisome position: ** 29.80519...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE] == * smiles: ** C=C(OC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE] == |
− | * | + | * smiles: |
− | ** | + | ** C=C(OC3(C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(NC(C)=O)3))C(=O)[O-] |
− | * | + | * common name: |
− | ** | + | ** UDP-N-acetyl-α-D-glucosamine-enolpyruvate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=BEGZZYPUNCJHKP-DBYWSUQTSA-K |
− | * | + | * molecular weight: |
− | ** | + | ** 674.382 |
* Synonym(s): | * Synonym(s): | ||
+ | ** UDP-N-acetyl-3-O-(1-carboxyvinyl)-α-D-glucosamine | ||
+ | ** UDP-N-acetyl-α-D-glucosamine-3-O-pyruvate ether | ||
+ | ** UDP-N-acetyl-3-(1-carboxyvinyl)-α-D-glucosamine | ||
+ | ** UDP-GlcNAc-pyruvate enol ether | ||
+ | ** UDP-GlcNAc-enolpyruvate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[UDPNACETYLMURAMATEDEHYDROG-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244881 25244881] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=68483 68483] |
− | {{#set: | + | * BIGG : uaccg |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04631 C04631] | ||
+ | {{#set: smiles=C=C(OC3(C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(NC(C)=O)3))C(=O)[O-]}} | ||
+ | {{#set: common name=UDP-N-acetyl-α-D-glucosamine-enolpyruvate}} | ||
+ | {{#set: inchi key=InChIKey=BEGZZYPUNCJHKP-DBYWSUQTSA-K}} | ||
+ | {{#set: molecular weight=674.382 }} | ||
+ | {{#set: common name=UDP-N-acetyl-3-O-(1-carboxyvinyl)-α-D-glucosamine|UDP-N-acetyl-α-D-glucosamine-3-O-pyruvate ether|UDP-N-acetyl-3-(1-carboxyvinyl)-α-D-glucosamine|UDP-GlcNAc-pyruvate enol ether|UDP-GlcNAc-enolpyruvate}} | ||
+ | {{#set: consumed by=UDPNACETYLMURAMATEDEHYDROG-RXN}} |
Latest revision as of 19:57, 21 March 2018
Contents
Metabolite UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE
- smiles:
- C=C(OC3(C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(NC(C)=O)3))C(=O)[O-]
- common name:
- UDP-N-acetyl-α-D-glucosamine-enolpyruvate
- inchi key:
- InChIKey=BEGZZYPUNCJHKP-DBYWSUQTSA-K
- molecular weight:
- 674.382
- Synonym(s):
- UDP-N-acetyl-3-O-(1-carboxyvinyl)-α-D-glucosamine
- UDP-N-acetyl-α-D-glucosamine-3-O-pyruvate ether
- UDP-N-acetyl-3-(1-carboxyvinyl)-α-D-glucosamine
- UDP-GlcNAc-pyruvate enol ether
- UDP-GlcNAc-enolpyruvate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C(OC3(C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(NC(C)=O)3))C(=O)[O-" cannot be used as a page name in this wiki.