Difference between revisions of "PWY66-394"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11408 CPD-11408] == * smiles: ** C2(C=C(OS(=O)(=O)[O-])C(=CC(OC1(C(=CC(=CC(I)=1)CC(C(=O)[O-...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-3-methyladenines DNA-3-methyladenines] == * common name: ** an N3-methyladenine in DNA * Sy...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11408 CPD-11408] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-3-methyladenines DNA-3-methyladenines] ==
* smiles:
+
** C2(C=C(OS(=O)(=O)[O-])C(=CC(OC1(C(=CC(=CC(I)=1)CC(C(=O)[O-])[N+])I))=2)I)
+
* inchi key:
+
** InChIKey=XBQYQXVJBNDCGY-LBPRGKRZSA-M
+
 
* common name:
 
* common name:
** triiodothyronine sulfate
+
** an N3-methyladenine in DNA
* molecular weight:
+
** 730.028   
+
 
* Synonym(s):
 
* Synonym(s):
** triiodothyronine sulfuric ester
+
** a DNA with N3-methyladenine
** 3,3',5-triiodo-L-thyronine sulfate
+
** 3,5-diiodo-O-[3-iodo-4-(sulfooxy)phenyl]-L-tyrosine
+
** L-tyrosine, 3,5-diiodo-O-(3-iodo-4-(sulfooxy)phenyl)-
+
** (2S)-2-amino-3-{3,5-diiodo-4-[3-iodo-4-(sulfooxy)phenoxy]phenyl}propanoic acid
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-5189]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10615]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an N3-methyladenine in DNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657986 90657986]
+
{{#set: common name=a DNA with N3-methyladenine}}
* CHEBI:
+
{{#set: consumed by=RXN0-5189}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35432 35432]
+
* METABOLIGHTS : MTBLC35432
+
* HMDB : HMDB03036
+
{{#set: smiles=C2(C=C(OS(=O)(=O)[O-])C(=CC(OC1(C(=CC(=CC(I)=1)CC(C(=O)[O-])[N+])I))=2)I)}}
+
{{#set: inchi key=InChIKey=XBQYQXVJBNDCGY-LBPRGKRZSA-M}}
+
{{#set: common name=triiodothyronine sulfate}}
+
{{#set: molecular weight=730.028    }}
+
{{#set: common name=triiodothyronine sulfuric ester|3,3',5-triiodo-L-thyronine sulfate|3,5-diiodo-O-[3-iodo-4-(sulfooxy)phenyl]-L-tyrosine|L-tyrosine, 3,5-diiodo-O-(3-iodo-4-(sulfooxy)phenyl)-|(2S)-2-amino-3-{3,5-diiodo-4-[3-iodo-4-(sulfooxy)phenoxy]phenyl}propanoic acid}}
+
{{#set: produced by=RXN-10615}}
+

Revision as of 16:27, 10 January 2018

Metabolite DNA-3-methyladenines

  • common name:
    • an N3-methyladenine in DNA
  • Synonym(s):
    • a DNA with N3-methyladenine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links