Difference between revisions of "CPD-9699"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_15962 == * right end position: ** 2824 * transcription direction: ** POSITIVE * left end position: ** 307 * centisome position: ** 6.562634...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == * smiles: ** C=C1(C(CC([N+])C([O-])=O)C1) * common name: ** hypoglycin A...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == |
| − | * | + | * smiles: |
| − | ** | + | ** C=C1(C(CC([N+])C([O-])=O)C1) |
| − | * | + | * common name: |
| − | ** | + | ** hypoglycin A |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 141.169 |
* Synonym(s): | * Synonym(s): | ||
| + | ** hypoglycine | ||
| + | ** hypoglycine A | ||
| + | ** hypoglycin | ||
| + | ** L-β-(methylenecyclopropyl)-alanine | ||
| + | ** 2-amino-3-(2-methylidenecyclopropyl)propanoic acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-9157]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244430 25244430] |
| − | {{#set: | + | * HMDB : HMDB29427 |
| − | {{#set: | + | * Wikipedia : Hypoglycin |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C08287 C08287] |
| + | {{#set: smiles=C=C1(C(CC([N+])C([O-])=O)C1)}} | ||
| + | {{#set: common name=hypoglycin A}} | ||
| + | {{#set: inchi key=InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N}} | ||
| + | {{#set: molecular weight=141.169 }} | ||
| + | {{#set: common name=hypoglycine|hypoglycine A|hypoglycin|L-β-(methylenecyclopropyl)-alanine|2-amino-3-(2-methylidenecyclopropyl)propanoic acid}} | ||
| + | {{#set: consumed by=RXN-9157}} | ||
Latest revision as of 19:57, 21 March 2018
Contents
Metabolite CPD-9699
- smiles:
- C=C1(C(CC([N+])C([O-])=O)C1)
- common name:
- hypoglycin A
- inchi key:
- InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N
- molecular weight:
- 141.169
- Synonym(s):
- hypoglycine
- hypoglycine A
- hypoglycin
- L-β-(methylenecyclopropyl)-alanine
- 2-amino-3-(2-methylidenecyclopropyl)propanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C(CC([N+])C([O-])=O)C1)" cannot be used as a page name in this wiki.
