Difference between revisions of "SEROTONIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Holo-EntB Holo-EntB] == * common name: ** a holo-[EntB isochorismatase/aryl-carrier protein] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SEROTONIN SEROTONIN] == * smiles: ** C1(=C(CC[N+])C2(C=C(O)C=CC(N1)=2)) * common name: ** serot...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SEROTONIN SEROTONIN] == |
| + | * smiles: | ||
| + | ** C1(=C(CC[N+])C2(C=C(O)C=CC(N1)=2)) | ||
* common name: | * common name: | ||
| − | ** | + | ** serotonin |
| + | * inchi key: | ||
| + | ** InChIKey=QZAYGJVTTNCVMB-UHFFFAOYSA-O | ||
| + | * molecular weight: | ||
| + | ** 177.225 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 5-HT | ||
| + | ** hydroxytryptamine | ||
| + | ** 5-hydroxytryptamine | ||
| + | ** 3-(2-aminoethyl)-1H-indol-5-ol | ||
| + | ** enteramine | ||
| + | ** thrombocytin | ||
| + | ** thrombotonin | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10777]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 50-67-9 |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4048638 4048638] | ||
| + | * HMDB : HMDB00259 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00780 C00780] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.3264617.html 3264617] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=350546 350546] | ||
| + | * METABOLIGHTS : MTBLC350546 | ||
| + | {{#set: smiles=C1(=C(CC[N+])C2(C=C(O)C=CC(N1)=2))}} | ||
| + | {{#set: common name=serotonin}} | ||
| + | {{#set: inchi key=InChIKey=QZAYGJVTTNCVMB-UHFFFAOYSA-O}} | ||
| + | {{#set: molecular weight=177.225 }} | ||
| + | {{#set: common name=5-HT|hydroxytryptamine|5-hydroxytryptamine|3-(2-aminoethyl)-1H-indol-5-ol|enteramine|thrombocytin|thrombotonin}} | ||
| + | {{#set: consumed by=RXN-10777}} | ||
Latest revision as of 19:57, 21 March 2018
Contents
Metabolite SEROTONIN
- smiles:
- C1(=C(CC[N+])C2(C=C(O)C=CC(N1)=2))
- common name:
- serotonin
- inchi key:
- InChIKey=QZAYGJVTTNCVMB-UHFFFAOYSA-O
- molecular weight:
- 177.225
- Synonym(s):
- 5-HT
- hydroxytryptamine
- 5-hydroxytryptamine
- 3-(2-aminoethyl)-1H-indol-5-ol
- enteramine
- thrombocytin
- thrombotonin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 50-67-9
- PUBCHEM:
- HMDB : HMDB00259
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC350546
"C1(=C(CC[N+])C2(C=C(O)C=CC(N1)=2))" cannot be used as a page name in this wiki.
