Difference between revisions of "Tiso gene 15962"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * common name: ** β-D-gala...")
(Created page with "Category:Gene == Gene Tiso_gene_15962 == * right end position: ** 2824 * transcription direction: ** POSITIVE * left end position: ** 307 * centisome position: ** 6.562634...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] ==
+
== Gene Tiso_gene_15962 ==
−
* smiles:
+
* right end position:
−
** C(O)C1(OC(O)C(O)C(O)C(O)1)
+
** 2824
−
* common name:
+
* transcription direction:
−
** β-D-galactose
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=WQZGKKKJIJFFOK-FPRJBGLDSA-N
+
** 307
−
* molecular weight:
+
* centisome position:
−
** 180.157    
+
** 6.562634    
 
* Synonym(s):
 
* Synonym(s):
−
** β-D-galactopyranose
 
−
** cerebrose
 
−
** 6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PEROXID-RXN]]
−
* [[BETAGALACTOSID-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
−
* [[ALDOSE1EPIM-RXN]]
+
* Reaction: [[RXN-12440]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14240]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15288]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17352]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-3521]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-8635]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7214]]
 +
* [[PWY-6824]]
 +
* [[PWY-6959]]
 +
* [[PWY-5461]]
 +
* [[PWY-7445]]
 +
* [[PWY-5469]]
 +
* [[PWY-5466]]
 +
* [[PWY-6960]]
 +
* [[PWY-6961]]
 +
* [[PWY-2261]]
 
== External links  ==
 
== External links  ==
−
* CAS : 7296-64-2
+
{{#set: right end position=2824}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439353 439353]
+
{{#set: left end position=307}}
−
* HMDB : HMDB03449
+
{{#set: centisome position=6.562634   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=PEROXID-RXN|RXN-12440|RXN-14240|RXN-15288|RXN-17352|RXN-3521|RXN-8635}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00962 C00962]
+
{{#set: pathway associated=PWY-7214|PWY-6824|PWY-6959|PWY-5461|PWY-7445|PWY-5469|PWY-5466|PWY-6960|PWY-6961|PWY-2261}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.388476.html 388476]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28034 28034]
+
−
* BIGG : gal
+
−
* BIGG : gal-bD
+
−
{{#set: smiles=C(O)C1(OC(O)C(O)C(O)C(O)1)}}
+
−
{{#set: common name=β-D-galactose}}
+
−
{{#set: inchi key=InChIKey=WQZGKKKJIJFFOK-FPRJBGLDSA-N}}
+
−
{{#set: molecular weight=180.157   }}
+
−
{{#set: common name=β-D-galactopyranose|cerebrose|6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol}}
+
−
{{#set: produced by=BETAGALACTOSID-RXN}}
+
−
{{#set: reversible reaction associated=ALDOSE1EPIM-RXN}}
+

Latest revision as of 19:57, 21 March 2018

Gene Tiso_gene_15962

  • right end position:
    • 2824
  • transcription direction:
    • POSITIVE
  • left end position:
    • 307
  • centisome position:
    • 6.562634
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15962&oldid=44922"