Difference between revisions of "Tiso gene 4219"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-469 CPD-469] == * smiles: ** CC(=O)NC(C([O-])=O)CC[CH]=O * common name: ** N-acetyl-L-gluta...") |
(Created page with "Category:Gene == Gene Tiso_gene_4219 == * Synonym(s): == Reactions associated == * Reaction: RXN-1884 ** Source: orthology-athaliana * Reaction: UDPGALor ** S...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4219 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-1884]] | |
− | + | ** Source: [[orthology-athaliana]] | |
− | * [[ | + | * Reaction: [[UDPGALor]] |
− | * [[ | + | ** Source: [[orthology-creinhardtii]] |
+ | == Pathways associated == | ||
+ | * [[PWY-882]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-1884|UDPGALor}} | |
− | + | {{#set: pathway associated=PWY-882}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 20:58, 21 March 2018
Gene Tiso_gene_4219
- Synonym(s):
Reactions associated
- Reaction: RXN-1884
- Source: orthology-athaliana
- Reaction: UDPGALor
- Source: orthology-creinhardtii