Difference between revisions of "PWY-7440"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3041 CPD-3041] == * smiles: ** C2(C=C(O)C=CC(C=CC(=O)C1(C(=CC(O)=CC=1)O))=2) * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13446 RXN-13446] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13446 RXN-13446] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/3.1.2 EC-3.1.2] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[CPD-14426]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-13792]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[PROTON]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 docosapentaenoyl-CoA[c] '''+''' 1 H2O[c] '''=>''' 1 (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentenoate[c] '''+''' 1 coenzyme A[c] '''+''' 1 H+[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_7477]] | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[athaliana]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-3.1.2}} | |
− | + | {{#set: gene associated=Tiso_gene_7477}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | {{#set: reconstruction source=athaliana}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:27, 10 January 2018
Contents
Reaction RXN-13446
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 docosapentaenoyl-CoA[c] + 1 H2O[c] => 1 (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentenoate[c] + 1 coenzyme A[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.