Difference between revisions of "3.2.1.113-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == * smiles: ** C=C1(C(CC([N+])C([O-])=O)C1) * common name: ** hypoglycin A...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.113-RXN 3.2.1.113-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** probable_alpha-mann...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.113-RXN 3.2.1.113-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** probable_alpha-mannosidase_i_mns5 |
− | * | + | ** mannosyl-oligosaccharide_-alpha-mannosidase_mns2 |
− | * | + | ** class_member_1 |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.2.1.113 EC-3.2.1.113] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[WATER]][c] '''+''' 1 [[Mannosyl9-Nacetylglucosaminyl2]][c] '''=>''' 1 [[MANNOSE]][c] '''+''' 1 [[Mannosyl8-Nacetylglucosaminyl2]][c] |
− | == | + | * With common name(s): |
+ | ** 1 H2O[c] '''+''' 1 a (mannosyl)9-(N-acetylglucosaminyl)2[c] '''=>''' 1 D-mannose[c] '''+''' 1 a (mannosyl)8-(N-acetylglucosaminyl)2[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_2719]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_4788]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_11681]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P45700 P45700] |
− | * | + | ** [http://www.uniprot.org/uniprot/P33908 P33908] |
− | * | + | ** [http://www.uniprot.org/uniprot/P31723 P31723] |
− | * | + | ** [http://www.uniprot.org/uniprot/O02773 O02773] |
− | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=probable_alpha-mannosidase_i_mns5}} |
− | {{#set: common name= | + | {{#set: common name=mannosyl-oligosaccharide_-alpha-mannosidase_mns2}} |
− | {{#set: | + | {{#set: common name=class_member_1}} |
− | {{#set: | + | {{#set: ec number=EC-3.2.1.113}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_2719|Tiso_gene_4788|Tiso_gene_11681}} |
− | {{#set: | + | {{#set: in pathway=}} |
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 20:58, 21 March 2018
Contents
Reaction 3.2.1.113-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- probable_alpha-mannosidase_i_mns5
- mannosyl-oligosaccharide_-alpha-mannosidase_mns2
- class_member_1
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 Mannosyl9-Nacetylglucosaminyl2[c] => 1 MANNOSE[c] + 1 Mannosyl8-Nacetylglucosaminyl2[c]
- With common name(s):
- 1 H2O[c] + 1 a (mannosyl)9-(N-acetylglucosaminyl)2[c] => 1 D-mannose[c] + 1 a (mannosyl)8-(N-acetylglucosaminyl)2[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_2719
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_4788
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_11681
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links