Difference between revisions of "5-HYDROXY-CONIFERALDEHYDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14219 RXN-14219] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * Synonym(s): == React...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14219 RXN-14219] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C
 +
* inchi key:
 +
** InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M
 
* common name:
 
* common name:
−
** ORF
+
** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
 +
* molecular weight:
 +
** 443.688   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-18]]
−
** 1 [[DUTP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[DUDP]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 dUTP[c] '''+''' 1 H2O[c] '''=>''' 1 dUDP[c] '''+''' 1 phosphate[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_20236]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_12899]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=ORF}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826592 91826592]
−
{{#set: gene associated=Tiso_gene_20236|Tiso_gene_12899}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87047 87047]
−
{{#set: reconstruction category=orthology}}
+
* HMDB : HMDB12165
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C}}
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: inchi key=InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=443.688    }}
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: consumed by=RXN66-18}}

Revision as of 16:27, 10 January 2018

Metabolite CPD-8613

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C
  • inchi key:
    • InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M
  • common name:
    • 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
  • molecular weight:
    • 443.688
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=5-HYDROXY-CONIFERALDEHYDE&oldid=13035"