|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12086 RXN-12086] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15688 CPD-15688] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CCCCCCC=CC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| * common name: | | * common name: |
− | ** ORF | + | ** 3-cis, 5-trans-dodecadienoyl-CoA |
− | ** zinc_finger_fyve_domain-containing_protein
| + | * inchi key: |
− | ** triacylglycerol_lipase | + | ** InChIKey=ARQUZFJQPYWSSL-NBLUIMTHSA-J |
− | ** class_3_lipase | + | * molecular weight: |
− | * ec number: | + | ** 941.776 |
− | ** [http://enzyme.expasy.org/EC/3.1.1.3 EC-3.1.1.3] | + | |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[CPD-13014]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[BUTYRIC_ACID]][c] '''+''' 1 [[CPD-13040]][c]
| + | * [[RXN-14799]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 tributyrin[c] '''+''' 1 H2O[c] '''=>''' 1 H+[c] '''+''' 1 butanoate[c] '''+''' 1 1,2-dibutyrin[c]
| + | |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * Gene: [[Tiso_gene_7915]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_9140]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_8902]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: AUTOMATED-NAME-MATCH
| + | |
− | * Gene: [[Tiso_gene_288]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: AUTOMATED-NAME-MATCH
| + | |
− | * Gene: [[Tiso_gene_906]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_11437]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_2108]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_14064]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_17612]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_2983]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_19184]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_5716]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | * Gene: [[Tiso_gene_2109]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_16817]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | * Gene: [[Tiso_gene_3215]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | * Gene: [[Tiso_gene_14063]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_14062]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_17143]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_14109]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_17613]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_17614]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | * Gene: [[Tiso_gene_17639]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_905]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | == Pathways == | + | |
− | == Reconstruction information ==
| + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | {{#set: direction=LEFT-TO-RIGHT}}
| + | * PUBCHEM: |
− | {{#set: common name=ORF}}
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657300 90657300] |
− | {{#set: common name=zinc_finger_fyve_domain-containing_protein}} | + | {{#set: smiles=CCCCCCC=CC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: common name=triacylglycerol_lipase}}
| + | {{#set: common name=3-cis, 5-trans-dodecadienoyl-CoA}} |
− | {{#set: common name=class_3_lipase}} | + | {{#set: inchi key=InChIKey=ARQUZFJQPYWSSL-NBLUIMTHSA-J}} |
− | {{#set: ec number=EC-3.1.1.3}}
| + | {{#set: molecular weight=941.776 }} |
− | {{#set: gene associated=Tiso_gene_7915|Tiso_gene_9140|Tiso_gene_8902|Tiso_gene_288|Tiso_gene_906|Tiso_gene_11437|Tiso_gene_2108|Tiso_gene_14064|Tiso_gene_17612|Tiso_gene_2983|Tiso_gene_19184|Tiso_gene_5716|Tiso_gene_2109|Tiso_gene_16817|Tiso_gene_3215|Tiso_gene_14063|Tiso_gene_14062|Tiso_gene_17143|Tiso_gene_14109|Tiso_gene_17613|Tiso_gene_17614|Tiso_gene_17639|Tiso_gene_905}} | + | {{#set: produced by=RXN-14799}} |
− | {{#set: in pathway=}}
| + | |
− | {{#set: reconstruction category=orthology|annotation}} | + | |
− | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}} | + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}}
| + | |