Difference between revisions of "Tiso gene 18933"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7183 PWY-7183] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * inchi key: ** InChIKey=VYEGBDH...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7183 PWY-7183] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** C1(C(C(C(C(C1O)O)=O)O)O)O
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
* inchi key:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
** InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
 
* common name:
 
* common name:
−
** pyrimidine nucleobases salvage I
+
** scyllo-inosose
 +
* molecular weight:
 +
** 178.141   
 
* Synonym(s):
 
* Synonym(s):
−
** uracil salvage
+
** 2-keto-myo-inositol
 +
** 2,4,6/3,5-pentahydroxycyclohexanone
 +
** 2-inosose
 +
** 2-keto-scyllo-inositol
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
* '''1''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
−
** [[URACIL-PRIBOSYLTRANS-RXN]]
+
== Reaction(s) of unknown directionality ==
−
== Reaction(s) not found ==
+
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
−
* '''0''' reaction(s) not found
+
 
== External links  ==
 
== External links  ==
−
* ECOCYC:
+
* PUBCHEM:
−
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7183 PWY-7183]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439294 439294]
−
{{#set: taxonomic range=TAX-4751}}
+
* CHEBI:
−
{{#set: taxonomic range=TAX-33090}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17811 17811]
−
{{#set: taxonomic range=TAX-2157}}
+
{{#set: smiles=C1(C(C(C(C(C1O)O)=O)O)O)O}}
−
{{#set: taxonomic range=TAX-2}}
+
{{#set: inchi key=InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N}}
−
{{#set: common name=pyrimidine nucleobases salvage I}}
+
{{#set: common name=scyllo-inosose}}
−
{{#set: common name=uracil salvage}}
+
{{#set: molecular weight=178.141    }}
−
{{#set: reaction found=1}}
+
{{#set: common name=2-keto-myo-inositol|2,4,6/3,5-pentahydroxycyclohexanone|2-inosose|2-keto-scyllo-inositol}}
−
{{#set: reaction not found=0}}
+
{{#set: consumed or produced by=MYO-INOSITOL-2-DEHYDROGENASE-RXN}}

Revision as of 16:27, 10 January 2018

Metabolite CPD-14808

  • smiles:
    • C1(C(C(C(C(C1O)O)=O)O)O)O
  • inchi key:
    • InChIKey=VYEGBDHSGHXOGT-HYFGLKJPSA-N
  • common name:
    • scyllo-inosose
  • molecular weight:
    • 178.141
  • Synonym(s):
    • 2-keto-myo-inositol
    • 2,4,6/3,5-pentahydroxycyclohexanone
    • 2-inosose
    • 2-keto-scyllo-inositol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18933&oldid=13047"