Difference between revisions of "RXN-18201"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] == * smiles: ** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18201 RXN-18201] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18201 RXN-18201] ==
* smiles:
+
* direction:
** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* common name:
+
** 3-oxo-(5Z)-dodecenoyl-CoA
+
* inchi key:
+
** InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J
+
* molecular weight:
+
** 957.775   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-12:1-Δ5-CoA
 
** 3-oxo-5-cis-dodecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-17799]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[CPD-19487]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPDQT-41]][c]
* [[RXN-17798]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 H+[c] '''+''' 1 3-isopropyl-10-(methylthio)-2-oxodecanoate[c] '''=>''' 1 CO2[c] '''+''' 1 10-(methylthio)-2-oxodecanoate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWYQT-4450]], aliphatic glucosinolate biosynthesis, side chain elongation cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4450 PWYQT-4450]
 +
** '''10''' reactions found over '''30''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: common name=3-oxo-(5Z)-dodecenoyl-CoA}}
+
{{#set: in pathway=PWYQT-4450}}
{{#set: inchi key=InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J}}
+
{{#set: reconstruction category=annotation}}
{{#set: molecular weight=957.775    }}
+
{{#set: reconstruction source=annotation-experimental_annotation}}
{{#set: common name=3-oxo-12:1-Δ5-CoA|3-oxo-5-cis-dodecenoyl-CoA}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: consumed by=RXN-17799}}
+
{{#set: produced by=RXN-17798}}
+

Latest revision as of 20:00, 21 March 2018

Reaction RXN-18201

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H+[c] + 1 3-isopropyl-10-(methylthio)-2-oxodecanoate[c] => 1 CO2[c] + 1 10-(methylthio)-2-oxodecanoate[c]

Genes associated with this reaction

Pathways

  • PWYQT-4450, aliphatic glucosinolate biosynthesis, side chain elongation cycle: PWYQT-4450
    • 10 reactions found over 30 reactions in the full pathway

Reconstruction information

External links