Difference between revisions of "Tiso gene 18559"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17372 CPD-17372] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O * common...") |
(Created page with "Category:Gene == Gene Tiso_gene_18559 == * right end position: ** 2300 * transcription direction: ** POSITIVE * left end position: ** 587 * centisome position: ** 14.08687...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18559 == |
− | * | + | * right end position: |
− | ** | + | ** 2300 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 587 |
− | * | + | * centisome position: |
− | ** | + | ** 14.086872 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[RXN-8281]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PWY-5338]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2300}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: left end position=587}} |
− | {{#set: | + | {{#set: centisome position=14.086872 }} |
− | {{#set: | + | {{#set: reaction associated=RXN-8281}} |
− | {{#set: | + | {{#set: pathway associated=PWY-5338}} |
− | {{#set: | + |
Latest revision as of 21:00, 21 March 2018
Gene Tiso_gene_18559
- right end position:
- 2300
- transcription direction:
- POSITIVE
- left end position:
- 587
- centisome position:
- 14.086872
- Synonym(s):
Reactions associated
- Reaction: RXN-8281
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation