Difference between revisions of "CPD-15373"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] == * smiles: ** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2)) * common name: ** nicotin...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)CO * common name: ** aldehydo-D-ma...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] == |
* smiles: | * smiles: | ||
| − | ** | + | ** [CH](=O)C(O)C(O)C(O)C(O)CO |
* common name: | * common name: | ||
| − | ** | + | ** aldehydo-D-mannose |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 180.157 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14501]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[1.1.1.255-RXN]] | ||
| + | * [[RXN-14500]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=161658 161658] |
| − | * | + | * CHEBI: |
| − | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=37675 37675] |
| − | + | {{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)CO}} | |
| − | {{#set: smiles= | + | {{#set: common name=aldehydo-D-mannose}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=180.157 }} |
| − | {{#set: molecular weight= | + | {{#set: consumed by=RXN-14501}} |
| − | {{#set: | + | {{#set: reversible reaction associated=1.1.1.255-RXN|RXN-14500}} |
| − | {{#set: | + | |
Latest revision as of 20:01, 21 March 2018
Contents
Metabolite CPD-15373
- smiles:
- [CH](=O)C(O)C(O)C(O)C(O)CO
- common name:
- aldehydo-D-mannose
- inchi key:
- InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N
- molecular weight:
- 180.157
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.
