Difference between revisions of "DIMETHYL-D-RIBITYL-LUMAZINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13698 RXN-13698] == * direction: ** REVERSIBLE * common name: ** alanine_aminotransferase_mitoc...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMETHYL-D-RIBITYL-LUMAZINE DIMETHYL-D-RIBITYL-LUMAZINE] == * smiles: ** CC2(=C(C)N(CC(O)C(O)C(...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13698 RXN-13698] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMETHYL-D-RIBITYL-LUMAZINE DIMETHYL-D-RIBITYL-LUMAZINE] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC2(=C(C)N(CC(O)C(O)C(O)CO)C1(C(C(=O)[N-]C(=O)N=1)=N2))
 
* common name:
 
* common name:
−
** alanine_aminotransferase_mitochondrial
+
** 6,7-dimethyl-8-(1-D-ribityl)lumazine
−
** alanine_aminotransferase
+
* inchi key:
−
* ec number:
+
** InChIKey=SXDXRJZUAJBNFL-XKSSXDPKSA-M
−
** [http://enzyme.expasy.org/EC/2.6.1.2 EC-2.6.1.2]
+
* molecular weight:
 +
** 325.3   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RIBOFLAVIN-SYN-RXN]]
−
** 1 [[L-ALPHA-ALANINE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''<=>''' 1 [[PYRUVATE]][c] '''+''' 1 [[GLT]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 L-alanine[c] '''+''' 1 2-oxoglutarate[c] '''<=>''' 1 pyruvate[c] '''+''' 1 L-glutamate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_10957]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_5959]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-7117]], C4 photosynthetic carbon assimilation cycle, PEPCK type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7117 PWY-7117]
+
−
** '''7''' reactions found over '''10''' reactions in the full pathway
+
−
* [[PWY-7115]], C4 photosynthetic carbon assimilation cycle, NAD-ME type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7115 PWY-7115]
+
−
** '''7''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* LIGAND-CPD:
−
{{#set: common name=alanine_aminotransferase_mitochondrial}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04332 C04332]
−
{{#set: common name=alanine_aminotransferase}}
+
* HMDB : HMDB03826
−
{{#set: ec number=EC-2.6.1.2}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_10957|Tiso_gene_5959}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58201 58201]
−
{{#set: in pathway=PWY-7117|PWY-7115}}
+
* BIGG : dmlz
−
{{#set: reconstruction category=orthology|annotation}}
+
* PUBCHEM:
−
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46931117 46931117]
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
{{#set: smiles=CC2(=C(C)N(CC(O)C(O)C(O)CO)C1(C(C(=O)[N-]C(=O)N=1)=N2))}}
 +
{{#set: common name=6,7-dimethyl-8-(1-D-ribityl)lumazine}}
 +
{{#set: inchi key=InChIKey=SXDXRJZUAJBNFL-XKSSXDPKSA-M}}
 +
{{#set: molecular weight=325.3    }}
 +
{{#set: consumed by=RIBOFLAVIN-SYN-RXN}}

Latest revision as of 21:01, 21 March 2018

Metabolite DIMETHYL-D-RIBITYL-LUMAZINE

  • smiles:
    • CC2(=C(C)N(CC(O)C(O)C(O)CO)C1(C(C(=O)[N-]C(=O)N=1)=N2))
  • common name:
    • 6,7-dimethyl-8-(1-D-ribityl)lumazine
  • inchi key:
    • InChIKey=SXDXRJZUAJBNFL-XKSSXDPKSA-M
  • molecular weight:
    • 325.3
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC2(=C(C)N(CC(O)C(O)C(O)CO)C1(C(C(=O)[N-]C(=O)N=1)=N2))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DIMETHYL-D-RIBITYL-LUMAZINE&oldid=45248"