Difference between revisions of "Tiso gene 11842"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] == * smiles: ** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2) * common name...")
(Created page with "Category:Gene == Gene Tiso_gene_11842 == * right end position: ** 9843 * transcription direction: ** POSITIVE * left end position: ** 7988 * centisome position: ** 54.3475...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] ==
+
== Gene Tiso_gene_11842 ==
−
* smiles:
+
* right end position:
−
** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2)
+
** 9843
−
* common name:
+
* transcription direction:
−
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N
+
** 7988
−
* molecular weight:
+
* centisome position:
−
** 298.374    
+
** 54.347534    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP
 
−
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione
 
−
** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine
 
−
** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP
 
−
** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-15684]]
+
* Reaction: [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=9843}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658023 90658023]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2)}}
+
{{#set: left end position=7988}}
−
{{#set: common name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: centisome position=54.347534   }}
−
{{#set: inchi key=InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N}}
+
{{#set: reaction associated=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}}
−
{{#set: molecular weight=298.374   }}
+
−
{{#set: common name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP|3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione}}
+
−
{{#set: consumed by=RXN-15684}}
+

Latest revision as of 20:01, 21 March 2018

Gene Tiso_gene_11842

  • right end position:
    • 9843
  • transcription direction:
    • POSITIVE
  • left end position:
    • 7988
  • centisome position:
    • 54.347534
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11842&oldid=45301"