Difference between revisions of "CPD-13576"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-GLN-tRNAs Charged-GLN-tRNAs] == * common name: ** an L-glutaminyl-[tRNAgln] * Synonym(s...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] == * smiles: ** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1) * common name:...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-GLN-tRNAs Charged-GLN-tRNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] ==
 +
* smiles:
 +
** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)
 
* common name:
 
* common name:
** an L-glutaminyl-[tRNAgln]
+
** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate
 +
* inchi key:
 +
** InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K
 +
* molecular weight:
 +
** 264.169   
 
* Synonym(s):
 
* Synonym(s):
** glutaminyl-tRNA
+
** cThz-P
** L-glutaminyl-tRNA(gln)
+
** gln-tRNA(gln)
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12610]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[6.3.5.7-RXN]]
 
* [[GLUTAMINE--TRNA-LIGASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=an L-glutaminyl-[tRNAgln]}}
+
* PUBCHEM:
{{#set: common name=glutaminyl-tRNA|L-glutaminyl-tRNA(gln)|gln-tRNA(gln)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53477624 53477624]
{{#set: produced by=6.3.5.7-RXN|GLUTAMINE--TRNA-LIGASE-RXN}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62890 62890]
 +
{{#set: smiles=CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)}}
 +
{{#set: common name=2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate}}
 +
{{#set: inchi key=InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K}}
 +
{{#set: molecular weight=264.169    }}
 +
{{#set: common name=cThz-P}}
 +
{{#set: consumed by=RXN-12610}}

Latest revision as of 20:02, 21 March 2018

Metabolite CPD-13576

  • smiles:
    • CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)
  • common name:
    • 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate
  • inchi key:
    • InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K
  • molecular weight:
    • 264.169
  • Synonym(s):
    • cThz-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)" cannot be used as a page name in this wiki.