Difference between revisions of "THZ-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_20270 == * right end position: ** 1561 * transcription direction: ** POSITIVE * left end position: ** 252 * centisome position: ** 15.86901...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] == * smiles: ** CC1(N=CSC(CCOP([O-])(=O)[O-])=1) * common name: ** 4-methyl-5-(2-p...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_20270 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] ==
* right end position:
+
* smiles:
** 1561
+
** CC1(N=CSC(CCOP([O-])(=O)[O-])=1)
* transcription direction:
+
* common name:
** POSITIVE
+
** 4-methyl-5-(2-phosphooxyethyl)thiazole
* left end position:
+
* inchi key:
** 252
+
** InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L
* centisome position:
+
* molecular weight:
** 15.869017    
+
** 221.167    
 
* Synonym(s):
 
* Synonym(s):
 +
** 4-4-methyl-5-(2-phosphonooxyethyl)-thiazole
 +
** 4-methyl-5-(2-phosphoethyl)-thiazole
 +
** THZ-P
 +
** 4-methyl-5-(β-hydroxyethyl)thiazole phosphate
 +
** HET-P
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[2.7.11.2-RXN]]
+
* [[THI-P-SYN-RXN]]
** Source: [[annotation-in-silico_annotation]]
+
== Reaction(s) known to produce the compound ==
*** Assignment: automated-name-match
+
* [[THIAZOLSYN3-RXN]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: right end position=1561}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245616 25245616]
{{#set: left end position=252}}
+
* CHEBI:
{{#set: centisome position=15.869017   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58296 58296]
{{#set: reaction associated=2.7.11.2-RXN}}
+
* BIGG : 4mpetz
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C04327 C04327]
 +
{{#set: smiles=CC1(N=CSC(CCOP([O-])(=O)[O-])=1)}}
 +
{{#set: common name=4-methyl-5-(2-phosphooxyethyl)thiazole}}
 +
{{#set: inchi key=InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L}}
 +
{{#set: molecular weight=221.167   }}
 +
{{#set: common name=4-4-methyl-5-(2-phosphonooxyethyl)-thiazole|4-methyl-5-(2-phosphoethyl)-thiazole|THZ-P|4-methyl-5-(β-hydroxyethyl)thiazole phosphate|HET-P}}
 +
{{#set: consumed by=THI-P-SYN-RXN}}
 +
{{#set: produced by=THIAZOLSYN3-RXN}}

Latest revision as of 20:02, 21 March 2018

Metabolite THZ-P

  • smiles:
    • CC1(N=CSC(CCOP([O-])(=O)[O-])=1)
  • common name:
    • 4-methyl-5-(2-phosphooxyethyl)thiazole
  • inchi key:
    • InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L
  • molecular weight:
    • 221.167
  • Synonym(s):
    • 4-4-methyl-5-(2-phosphonooxyethyl)-thiazole
    • 4-methyl-5-(2-phosphoethyl)-thiazole
    • THZ-P
    • 4-methyl-5-(β-hydroxyethyl)thiazole phosphate
    • HET-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC1(N=CSC(CCOP([O-])(=O)[O-])=1)" cannot be used as a page name in this wiki.