Difference between revisions of "RXN-18032"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] == * smiles: ** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2)) * common name: ** (S)-nico...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18032 RXN-18032] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18032 RXN-18032] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[HCO3]][c] '''<=>''' 1 [[CO3]][c] '''+''' 1 [[PROTON]][c] | |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 hydrogencarbonate[c] '''<=>''' 1 carbonate[c] '''+''' 1 H+[c] |
| − | == | + | |
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 20:03, 21 March 2018
Contents
Reaction RXN-18032
- direction:
- REVERSIBLE
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 hydrogencarbonate[c] <=> 1 carbonate[c] + 1 H+[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
