Difference between revisions of "Tiso gene 20504"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12724 CPD-12724] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(=C(O2)C=C(O)C(O)=C(O)3))) * com...") |
(Created page with "Category:Gene == Gene Tiso_gene_20504 == * Synonym(s): == Reactions associated == * Reaction: RXN-14177 ** Source: orthology-athaliana * Reaction: RXN0-5419 *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_20504 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[RXN-14177]] |
− | + | ** Source: [[orthology-athaliana]] | |
− | == | + | * Reaction: [[RXN0-5419]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-14177|RXN0-5419}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:03, 21 March 2018
Gene Tiso_gene_20504
- Synonym(s):
Reactions associated
- Reaction: RXN-14177
- Source: orthology-athaliana
- Reaction: RXN0-5419
- Source: orthology-esiliculosus