Difference between revisions of "CPD-356"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11480 RXN-11480] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-(acyl-carrier-pro...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-356 CPD-356] == * smiles: ** C(O)C1(OC(=O)C(O)C(O)1) * common name: ** D-arabinono-1,4-lact...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11480 RXN-11480] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-356 CPD-356] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C1(OC(=O)C(O)C(O)1)
 
* common name:
 
* common name:
−
** 3-oxoacyl-(acyl-carrier-protein)
+
** D-arabinono-1,4-lactone
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
+
** InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N
 +
* molecular weight:
 +
** 148.115   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[1.1.3.37-RXN]]
−
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[3-Ketopimeloyl-ACP-methyl-esters]][c] '''=>''' 1 [[3-hydroxypimeloyl-ACP-methyl-esters]][c] '''+''' 1 [[NADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 a 3-oxo-pimeloyl-[acp] methyl ester[c] '''=>''' 1 a (3R)-3-hydroxypimeloyl-[acp] methyl ester[c] '''+''' 1 NADP+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_13083]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-esiliculosus]]
+
−
* Gene: [[Tiso_gene_9885]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519]
+
−
** '''9''' reactions found over '''11''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=3-oxoacyl-(acyl-carrier-protein)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=17723 17723]
−
{{#set: ec number=EC-1.1.1.100}}
+
* CHEMSPIDER:
−
{{#set: gene associated=Tiso_gene_13083|Tiso_gene_9885}}
+
** [http://www.chemspider.com/Chemical-Structure.16751.html 16751]
−
{{#set: in pathway=PWY-6519}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology|annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16292 16292]
−
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00652 C00652]
 +
{{#set: smiles=C(O)C1(OC(=O)C(O)C(O)1)}}
 +
{{#set: common name=D-arabinono-1,4-lactone}}
 +
{{#set: inchi key=InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N}}
 +
{{#set: molecular weight=148.115    }}
 +
{{#set: consumed by=1.1.3.37-RXN}}

Latest revision as of 20:03, 21 March 2018

Metabolite CPD-356

  • smiles:
    • C(O)C1(OC(=O)C(O)C(O)1)
  • common name:
    • D-arabinono-1,4-lactone
  • inchi key:
    • InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N
  • molecular weight:
    • 148.115
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-356&oldid=45568"