Difference between revisions of "Tiso gene 15721"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13040 CPD-13040] == * smiles: ** CCCC(OCC(OC(CCC)=O)CO)=O * common name: ** 1,2-dibutyrin *...")
(Created page with "Category:Gene == Gene Tiso_gene_15721 == * right end position: ** 4790 * transcription direction: ** NEGATIVE * left end position: ** 1031 * centisome position: ** 21.2708...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13040 CPD-13040] ==
+
== Gene Tiso_gene_15721 ==
−
* smiles:
+
* right end position:
−
** CCCC(OCC(OC(CCC)=O)CO)=O
+
** 4790
−
* common name:
+
* transcription direction:
−
** 1,2-dibutyrin
+
** NEGATIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=AWHAUPZHZYUHOM-VIFPVBQESA-N
+
** 1031
−
* molecular weight:
+
* centisome position:
−
** 232.276    
+
** 21.27089    
 
* Synonym(s):
 
* Synonym(s):
−
** glycerol 1,2-dibutanoate
 
−
** β-dibutyrin
 
−
** butanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester
 
−
** dibutyrylglycerol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.7.1.68-RXN]]
−
* [[RXN-12086]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6352]]
 +
* [[PWY-6351]]
 
== External links  ==
 
== External links  ==
−
* CAS : 24814-35-5
+
{{#set: right end position=4790}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5327007 5327007]
+
{{#set: left end position=1031}}
−
* CHEMSPIDER:
+
{{#set: centisome position=21.27089   }}
−
** [http://www.chemspider.com/Chemical-Structure.8352519.html 8352519]
+
{{#set: reaction associated=2.7.1.68-RXN}}
−
* CHEBI:
+
{{#set: pathway associated=PWY-6352|PWY-6351}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76537 76537]
+
−
{{#set: smiles=CCCC(OCC(OC(CCC)=O)CO)=O}}
+
−
{{#set: common name=1,2-dibutyrin}}
+
−
{{#set: inchi key=InChIKey=AWHAUPZHZYUHOM-VIFPVBQESA-N}}
+
−
{{#set: molecular weight=232.276   }}
+
−
{{#set: common name=glycerol 1,2-dibutanoate|β-dibutyrin|butanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester|dibutyrylglycerol}}
+
−
{{#set: produced by=RXN-12086}}
+

Latest revision as of 20:03, 21 March 2018

Gene Tiso_gene_15721

  • right end position:
    • 4790
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 1031
  • centisome position:
    • 21.27089
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15721&oldid=45596"