Difference between revisions of "Tiso gene 2159"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15377 CPD-15377] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * common name: ** aldehydo-D-xylose...")
(Created page with "Category:Gene == Gene Tiso_gene_2159 == * right end position: ** 15716 * transcription direction: ** POSITIVE * left end position: ** 13819 * centisome position: ** 67.707...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15377 CPD-15377] ==
+
== Gene Tiso_gene_2159 ==
* smiles:
+
* right end position:
** [CH](=O)C(O)C(O)C(O)CO
+
** 15716
* common name:
+
* transcription direction:
** aldehydo-D-xylose
+
** POSITIVE
* inchi key:
+
* left end position:
** InChIKey=PYMYPHUHKUWMLA-VPENINKCSA-N
+
** 13819
* molecular weight:
+
* centisome position:
** 150.131    
+
** 67.70701    
 
* Synonym(s):
 
* Synonym(s):
** linear D-xylose
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PYRIMSYN3-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-14503]]
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-12610]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12611]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[THI-P-SYN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6907]]
 +
* [[PWY-6890]]
 +
* [[PWY-7356]]
 +
* [[PWY-7357]]
 +
* [[PWY-6894]]
 +
* [[PWY-6897]]
 +
* [[PWY-7282]]
 +
* [[PWY-6908]]
 +
* [[PWY-6893]]
 +
* [[PWY-6910]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=15716}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=644160 644160]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: left end position=13819}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15936 15936]
+
{{#set: centisome position=67.70701   }}
* METABOLIGHTS : MTBLC15936
+
{{#set: reaction associated=PYRIMSYN3-RXN|RXN-12610|RXN-12611|THI-P-SYN-RXN}}
* HMDB : HMDB60254
+
{{#set: pathway associated=PWY-6907|PWY-6890|PWY-7356|PWY-7357|PWY-6894|PWY-6897|PWY-7282|PWY-6908|PWY-6893|PWY-6910}}
{{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}}
+
{{#set: common name=aldehydo-D-xylose}}
+
{{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-VPENINKCSA-N}}
+
{{#set: molecular weight=150.131   }}
+
{{#set: common name=linear D-xylose}}
+
{{#set: reversible reaction associated=RXN-14503}}
+

Latest revision as of 20:04, 21 March 2018

Gene Tiso_gene_2159

  • right end position:
    • 15716
  • transcription direction:
    • POSITIVE
  • left end position:
    • 13819
  • centisome position:
    • 67.70701
  • Synonym(s):

Reactions associated

Pathways associated

External links