Difference between revisions of "Tiso gene 8398"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14300 CPD-14300] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
(Created page with "Category:Gene == Gene Tiso_gene_8398 == * right end position: ** 5351 * transcription direction: ** POSITIVE * left end position: ** 543 * centisome position: ** 5.2749176...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14300 CPD-14300] ==
+
== Gene Tiso_gene_8398 ==
* smiles:
+
* right end position:
** CCCCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 5351
* common name:
+
* transcription direction:
** 3-oxo-(11Z)-eicos-11-enoyl-CoA
+
** POSITIVE
* inchi key:
+
* left end position:
** InChIKey=ASKKPQKSCFYPPP-FVLDFCIYSA-J
+
** 543
* molecular weight:
+
* centisome position:
** 1069.99    
+
** 5.2749176    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-14484]]
+
* Reaction: [[RNA-LIGASE-ATP-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-13322]]
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-17925]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17926]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17927]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=5351}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581100 71581100]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: left end position=543}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74011 74011]
+
{{#set: centisome position=5.2749176   }}
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=RNA-LIGASE-ATP-RXN|RXN-17925|RXN-17926|RXN-17927}}
{{#set: common name=3-oxo-(11Z)-eicos-11-enoyl-CoA}}
+
{{#set: inchi key=InChIKey=ASKKPQKSCFYPPP-FVLDFCIYSA-J}}
+
{{#set: molecular weight=1069.99   }}
+
{{#set: consumed by=RXN-14484}}
+
{{#set: produced by=RXN-13322}}
+

Latest revision as of 20:04, 21 March 2018

Gene Tiso_gene_8398

  • right end position:
    • 5351
  • transcription direction:
    • POSITIVE
  • left end position:
    • 543
  • centisome position:
    • 5.2749176
  • Synonym(s):

Reactions associated

Pathways associated

External links