Difference between revisions of "INDOLE-3-GLYCOL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14136 RXN-14136] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(O)CO) * common name: *...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14136 RXN-14136] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C2(=C(C1(C=CC=CC=1N2))C(O)CO)
 
* common name:
 
* common name:
−
** ORF
+
** indole-3-glycol
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.1.4.46 EC-3.1.4.46]
+
** InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 177.202   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD0-2030]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[GLYCEROL-3P]][c] '''+''' 1 [[SER]][c]
+
* [[RXN-5424]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 glycerophosphoserine[c] '''+''' 1 H2O[c] '''=>''' 1 H+[c] '''+''' 1 sn-glycerol 3-phosphate[c] '''+''' 1 L-serine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_17232]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_5334]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29878 29878]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202910 25202910]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(O)CO)}}
−
{{#set: common name=ORF}}
+
{{#set: common name=indole-3-glycol}}
−
{{#set: ec number=EC-3.1.4.46}}
+
{{#set: inchi key=InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N}}
−
{{#set: gene associated=Tiso_gene_17232|Tiso_gene_5334}}
+
{{#set: molecular weight=177.202    }}
−
{{#set: in pathway=}}
+
{{#set: produced by=RXN-5424}}
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 20:05, 21 March 2018

Metabolite INDOLE-3-GLYCOL

  • smiles:
    • C2(=C(C1(C=CC=CC=1N2))C(O)CO)
  • common name:
    • indole-3-glycol
  • inchi key:
    • InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N
  • molecular weight:
    • 177.202
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=INDOLE-3-GLYCOL&oldid=45847"