Difference between revisions of "N-Ac-L-methionyl-L-glutamyl-Protein"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] == * smiles: ** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Ac-L-methionyl-L-glutamyl-Protein N-Ac-L-methionyl-L-glutamyl-Protein] == * common name: ** a...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Ac-L-methionyl-L-glutamyl-Protein N-Ac-L-methionyl-L-glutamyl-Protein] ==
* smiles:
+
** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O
+
 
* common name:
 
* common name:
** L-threonylcarbamoyladenylate
+
** an N-terminal Nα-acetyl-L-methionyl-L-glutamyl-[protein]
* inchi key:
+
** InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L
+
* molecular weight:
+
** 490.322   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14570]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17853]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an N-terminal Nα-acetyl-L-methionyl-L-glutamyl-[protein]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464565 71464565]
+
{{#set: produced by=RXN-17853}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73682 73682]
+
{{#set: smiles=CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O}}
+
{{#set: common name=L-threonylcarbamoyladenylate}}
+
{{#set: inchi key=InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L}}
+
{{#set: molecular weight=490.322    }}
+
{{#set: consumed by=RXN-14570}}
+

Latest revision as of 20:07, 21 March 2018

Metabolite N-Ac-L-methionyl-L-glutamyl-Protein

  • common name:
    • an N-terminal Nα-acetyl-L-methionyl-L-glutamyl-[protein]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an N-terminal Nα-acetyl-L-methionyl-L-glutamyl-[protein" cannot be used as a page name in this wiki.