Difference between revisions of "N-terminal-specific-UCP-E2-L-cysteine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLCOA BENZOYLCOA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-specific-UCP-E2-L-cysteine N-terminal-specific-UCP-E2-L-cysteine] == * common name:...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLCOA BENZOYLCOA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-specific-UCP-E2-L-cysteine N-terminal-specific-UCP-E2-L-cysteine] ==
−
* smiles:
+
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
 
* common name:
 
* common name:
−
** benzoyl-CoA
+
** an [N-terminal E2 ubiquitin-conjugating enzyme]-L-cysteine
−
* inchi key:
+
−
** InChIKey=VEVJTUNLALKRNO-TYHXJLICSA-J
+
−
* molecular weight:
+
−
** 867.61   
+
 
* Synonym(s):
 
* Synonym(s):
−
** S-benzoate coenzyme A
+
** an [N-terminal ubiquitin-conjugating enzyme E2]-L-cysteine
−
** benzoyl-S-CoA
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-15563]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-2006]]
+
* [[RXN-15564]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 102185-37-5
+
{{#set: common name=an [N-terminal E2 ubiquitin-conjugating enzyme]-L-cysteine}}
−
* PUBCHEM:
+
{{#set: common name=an [N-terminal ubiquitin-conjugating enzyme E2]-L-cysteine}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266596 45266596]
+
{{#set: consumed by=RXN-15563}}
−
* HMDB : HMDB02252
+
{{#set: produced by=RXN-15564}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57369 57369]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00512 C00512]
+
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
−
{{#set: common name=benzoyl-CoA}}
+
−
{{#set: inchi key=InChIKey=VEVJTUNLALKRNO-TYHXJLICSA-J}}
+
−
{{#set: molecular weight=867.61    }}
+
−
{{#set: common name=S-benzoate coenzyme A|benzoyl-S-CoA}}
+
−
{{#set: produced by=RXN-2006}}
+

Latest revision as of 20:07, 21 March 2018

Metabolite N-terminal-specific-UCP-E2-L-cysteine

  • common name:
    • an [N-terminal E2 ubiquitin-conjugating enzyme]-L-cysteine
  • Synonym(s):
    • an [N-terminal ubiquitin-conjugating enzyme E2]-L-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an [N-terminal E2 ubiquitin-conjugating enzyme]-L-cysteine" cannot be used as a page name in this wiki.
"an [N-terminal ubiquitin-conjugating enzyme E2]-L-cysteine" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=N-terminal-specific-UCP-E2-L-cysteine&oldid=46049"