Difference between revisions of "CPD-8978"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15587 RXN-15587] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.8...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8978 CPD-8978] == * smiles: ** CCOP([O-])(=O)[O-] * common name: ** ethylphosphate * inchi...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8978 CPD-8978] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCOP([O-])(=O)[O-] |
| − | * | + | * common name: |
| − | ** | + | ** ethylphosphate |
| + | * inchi key: | ||
| + | ** InChIKey=ZJXZSIYSNXKHEA-UHFFFAOYSA-L | ||
| + | * molecular weight: | ||
| + | ** 124.033 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-8748]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * | + | |
| − | + | ||
| − | == | + | |
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12691392 12691392] | |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10632660.html 10632660] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59760 59760] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC59760 |
| + | * HMDB : HMDB12228 | ||
| + | {{#set: smiles=CCOP([O-])(=O)[O-]}} | ||
| + | {{#set: common name=ethylphosphate}} | ||
| + | {{#set: inchi key=InChIKey=ZJXZSIYSNXKHEA-UHFFFAOYSA-L}} | ||
| + | {{#set: molecular weight=124.033 }} | ||
| + | {{#set: consumed by=RXN-8748}} | ||
Latest revision as of 20:07, 21 March 2018
Contents
Metabolite CPD-8978
- smiles:
- CCOP([O-])(=O)[O-]
- common name:
- ethylphosphate
- inchi key:
- InChIKey=ZJXZSIYSNXKHEA-UHFFFAOYSA-L
- molecular weight:
- 124.033
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCOP([O-])(=O)[O-" cannot be used as a page name in this wiki.
