Difference between revisions of "Tiso gene 13748"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1P RIBOSE-1P] == * smiles: ** C(O)C1(C(O)C(O)C(OP(=O)([O-])[O-])O1) * common name: ** &a...") |
(Created page with "Category:Gene == Gene Tiso_gene_13748 == * right end position: ** 3521 * transcription direction: ** POSITIVE * left end position: ** 523 * centisome position: ** 8.558337...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13748 == |
− | * | + | * right end position: |
− | ** | + | ** 3521 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 523 |
− | * | + | * centisome position: |
− | ** | + | ** 8.558337 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[TREHALA-RXN]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | + | *** Assignment: ec-number | |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[PWY0-1182]] |
− | * [[ | + | * [[PWY0-1466]] |
== External links == | == External links == | ||
− | + | {{#set: right end position=3521}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=523}} | |
− | + | {{#set: centisome position=8.558337 }} | |
− | + | {{#set: reaction associated=TREHALA-RXN}} | |
− | + | {{#set: pathway associated=PWY0-1182|PWY0-1466}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 20:07, 21 March 2018
Gene Tiso_gene_13748
- right end position:
- 3521
- transcription direction:
- POSITIVE
- left end position:
- 523
- centisome position:
- 8.558337
- Synonym(s):
Reactions associated
- Reaction: TREHALA-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation