Difference between revisions of "Tiso gene 13409"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10411 CPD-10411] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C(CC(O)2)=C(O)C=C(O)C=3))) * c...") |
(Created page with "Category:Gene == Gene Tiso_gene_13409 == * right end position: ** 3079 * transcription direction: ** POSITIVE * left end position: ** 489 * centisome position: ** 7.750832...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13409 == |
− | * | + | * right end position: |
− | ** | + | ** 3079 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 489 |
− | * | + | * centisome position: |
− | ** | + | ** 7.750832 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ADENOSINETRIPHOSPHATASE-RXN]] | |
− | * [[RXN- | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | * Reaction: [[ATPASE-RXN]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3079}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=489}} | |
− | + | {{#set: centisome position=7.750832 }} | |
− | + | {{#set: reaction associated=ADENOSINETRIPHOSPHATASE-RXN|ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:08, 21 March 2018
Gene Tiso_gene_13409
- right end position:
- 3079
- transcription direction:
- POSITIVE
- left end position:
- 489
- centisome position:
- 7.750832
- Synonym(s):
Reactions associated
- Reaction: ADENOSINETRIPHOSPHATASE-RXN
- Source: orthology-esiliculosus
- Reaction: ATPASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation