Difference between revisions of "RXN-14501"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSINE INOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6632 PWY-6632] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6632 PWY-6632] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** caffeine degradation IV (bacteria, via demethylation and oxidation) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | * '''4''' reaction(s) found |
| − | + | ** [[RXN-11520]] | |
| − | * [[ | + | ** [[RXN-11519]] |
| − | * [[RXN- | + | ** [[RXN-11521]] |
| − | * [[ | + | ** [[PWY-6538]] |
| − | == Reaction(s) | + | == Reaction(s) not found == |
| − | * | + | * '''0''' reaction(s) not found |
== External links == | == External links == | ||
| − | + | * LIGAND-MAP: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?map00232 map00232] | |
| − | + | * UM-BBD-PWY : caf | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=caffeine degradation IV (bacteria, via demethylation and oxidation)}} | |
| − | + | {{#set: reaction found=4}} | |
| − | * LIGAND- | + | {{#set: reaction not found=0}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | |
| − | * | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 16:29, 10 January 2018
Pathway PWY-6632
- taxonomic range:
- common name:
- caffeine degradation IV (bacteria, via demethylation and oxidation)
- Synonym(s):
Reaction(s) found
Reaction(s) not found
- 0 reaction(s) not found
External links
- LIGAND-MAP:
- UM-BBD-PWY : caf
