Difference between revisions of "RXN0-6513"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6513 RXN0-6513] == * direction: ** REVERSIBLE * common name: ** 2,3-dehydroadipyl-CoA hydratas...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6513 RXN0-6513] ==
−
* smiles:
+
* direction:
−
** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** REVERSIBLE
 
* common name:
 
* common name:
−
** 3,8-divinyl protochlorophyllide a
+
** 2,3-dehydroadipyl-CoA hydratase
−
* molecular weight:
+
−
** 608.935   
+
 
* Synonym(s):
 
* Synonym(s):
−
** divinylprotochlorophyllide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-5285]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[3-HYDROXYADIPYL-COA]][c] '''<=>''' 1.0 [[CPD0-2365]][c] '''+''' 1.0 [[WATER]][c]
−
* [[RXN-5284]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 (3S)-hydroxyadipyl-CoA[c] '''<=>''' 1.0 2,3-didehydroadipyl-CoA[c] '''+''' 1.0 H2O[c]
−
* [[RXN-17487]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6885]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14262]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_16145]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54743931 54743931]
+
{{#set: common name=2,3-dehydroadipyl-CoA hydratase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_6885|Tiso_gene_14262|Tiso_gene_16145}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58632 58632]
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11831 C11831]
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=3,8-divinyl protochlorophyllide a}}
+
−
{{#set: molecular weight=608.935    }}
+
−
{{#set: common name=divinylprotochlorophyllide}}
+
−
{{#set: consumed by=RXN-5285}}
+
−
{{#set: produced by=RXN-5284}}
+
−
{{#set: reversible reaction associated=RXN-17487}}
+

Latest revision as of 20:09, 21 March 2018

Reaction RXN0-6513

  • direction:
    • REVERSIBLE
  • common name:
    • 2,3-dehydroadipyl-CoA hydratase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 (3S)-hydroxyadipyl-CoA[c] <=> 1.0 2,3-didehydroadipyl-CoA[c] + 1.0 H2O[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN0-6513&oldid=46461"