Difference between revisions of "Non-Glucosylated-Glucose-Acceptors"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5677 PWY-5677] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == * smiles: ** C1(=CC(=O)OC(=CC(=O)[O-])1) * inchi key: ** InChIKey=AYFXP...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10608 CPD-10608] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C1(=CC(=O)OC(=CC(=O)[O-])1) |
| + | * inchi key: | ||
| + | ** InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** trans-dienelactone |
| + | * molecular weight: | ||
| + | ** 139.087 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 2-trans-dienelactone | ||
| + | ** trans-4-carboxymethylenebut-2-en-1,4-olide | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-9868]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543248 9543248] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.7822189.html 7822189] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C12838 C12838] | ||
| + | {{#set: smiles=C1(=CC(=O)OC(=CC(=O)[O-])1)}} | ||
| + | {{#set: inchi key=InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M}} | ||
| + | {{#set: common name=trans-dienelactone}} | ||
| + | {{#set: molecular weight=139.087 }} | ||
| + | {{#set: common name=2-trans-dienelactone|trans-4-carboxymethylenebut-2-en-1,4-olide}} | ||
| + | {{#set: consumed by=RXN-9868}} | ||
Revision as of 16:29, 10 January 2018
Contents
Metabolite CPD-10608
- smiles:
- C1(=CC(=O)OC(=CC(=O)[O-])1)
- inchi key:
- InChIKey=AYFXPGXAZMFWNH-ONEGZZNKSA-M
- common name:
- trans-dienelactone
- molecular weight:
- 139.087
- Synonym(s):
- 2-trans-dienelactone
- trans-4-carboxymethylenebut-2-en-1,4-olide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=CC(=O)OC(=CC(=O)[O-])1)" cannot be used as a page name in this wiki.
