Difference between revisions of "Acetic-Esters"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEOYL-COA OLEOYL-COA] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Acetic-Esters Acetic-Esters] == * common name: ** an acetic ester * Synonym(s): ** an acetyl es...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEOYL-COA OLEOYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Acetic-Esters Acetic-Esters] ==
* smiles:
+
** CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
 
* common name:
 
* common name:
** oleoyl-CoA
+
** an acetic ester
* inchi key:
+
** InChIKey=XDUHQPOXLUAVEE-BPMMELMSSA-J
+
* molecular weight:
+
** 1027.953   
+
 
* Synonym(s):
 
* Synonym(s):
** oloeyl-CoA (cis)
+
** an acetyl ester
** cis-octadec-9-enoyl-CoA
+
** (9Z)-octadec-9-enoyl-CoA
+
** 18:1 cis-9
+
** 18:1(n-9)
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15044]]
 
* [[RXN-15045]]
 
* [[RXN-9666]]
 
* [[RXN-15043]]
 
* [[RXN-13322]]
 
* [[RXN-15090]]
 
* [[RXN-17775]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9644]]
 
* [[RXN0-7239]]
 
* [[1.14.19.1-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-15036]]
+
* [[ALCOHOL-O-ACETYLTRANSFERASE-RXN]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=an acetic ester}}
** [http://www.genome.jp/dbget-bin/www_bget?C00510 C00510]
+
{{#set: common name=an acetyl ester}}
* HMDB : HMDB01322
+
{{#set: reversible reaction associated=ALCOHOL-O-ACETYLTRANSFERASE-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57387 57387]
+
* METABOLIGHTS : MTBLC57387
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245426 25245426]
+
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=oleoyl-CoA}}
+
{{#set: inchi key=InChIKey=XDUHQPOXLUAVEE-BPMMELMSSA-J}}
+
{{#set: molecular weight=1027.953    }}
+
{{#set: common name=oloeyl-CoA (cis)|cis-octadec-9-enoyl-CoA|(9Z)-octadec-9-enoyl-CoA|18:1 cis-9|18:1(n-9)}}
+
{{#set: consumed by=RXN-15044|RXN-15045|RXN-9666|RXN-15043|RXN-13322|RXN-15090|RXN-17775}}
+
{{#set: produced by=RXN-9644|RXN0-7239|1.14.19.1-RXN}}
+
{{#set: reversible reaction associated=RXN-15036}}
+

Latest revision as of 20:10, 21 March 2018

Metabolite Acetic-Esters

  • common name:
    • an acetic ester
  • Synonym(s):
    • an acetyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links