Difference between revisions of "Tiso gene 14019"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-SEROTONIN N-ACETYL-SEROTONIN] == * smiles: ** CC(=O)NCCC2(=CNC1(=C(C=C(O)C=C1)2)) * co...") |
(Created page with "Category:Gene == Gene Tiso_gene_14019 == * right end position: ** 4842 * transcription direction: ** NEGATIVE * left end position: ** 725 * centisome position: ** 12.29230...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14019 == |
− | * | + | * right end position: |
− | ** | + | ** 4842 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 725 |
− | * | + | * centisome position: |
− | ** | + | ** 12.292302 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN0-4261]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: automated-name-match | |
− | * | + | == Pathways associated == |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: right end position=4842}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=725}} | |
− | + | {{#set: centisome position=12.292302 }} | |
− | + | {{#set: reaction associated=RXN0-4261}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 21:10, 21 March 2018
Gene Tiso_gene_14019
- right end position:
- 4842
- transcription direction:
- NEGATIVE
- left end position:
- 725
- centisome position:
- 12.292302
- Synonym(s):
Reactions associated
- Reaction: RXN0-4261
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation