Difference between revisions of "RXN-527"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-]...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-527 RXN-527] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1.14...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-527 RXN-527] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))
+
** LEFT-TO-RIGHT
−
* common name:
+
* ec number:
−
** tetraiodothyroacetate ether glucuronide
+
** [http://enzyme.expasy.org/EC/1.14.11.23 EC-1.14.11.23]
−
* inchi key:
+
−
** InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L
+
−
* molecular weight:
+
−
** 921.943   
+
 
* Synonym(s):
 
* Synonym(s):
−
** tetraiodothyroacetic acid ether glucuronide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-10616]]
+
** 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[CPD-474]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[SUC]][c] '''+''' 1 [[CPD-520]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 2-oxoglutarate[c] '''+''' 1 (+)-taxifolin[c] '''+''' 1 oxygen[c] '''=>''' 1 CO2[c] '''+''' 1 H2O[c] '''+''' 1 succinate[c] '''+''' 1 quercetin[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3330]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-3101]], flavonol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3101 PWY-3101]
 +
** '''4''' reactions found over '''7''' reactions in the full pathway
 +
* [[PWY-5390]], rutin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5390 PWY-5390]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
* [[PWY-6787]], flavonoid biosynthesis (in equisetum): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6787 PWY-6787]
 +
** '''5''' reactions found over '''10''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659237 90659237]
+
** [http://www.genome.jp/dbget-bin/www_bget?R02160 R02160]
−
{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: common name=tetraiodothyroacetate ether glucuronide}}
+
{{#set: ec number=EC-1.14.11.23}}
−
{{#set: inchi key=InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L}}
+
{{#set: gene associated=Tiso_gene_3330}}
−
{{#set: molecular weight=921.943    }}
+
{{#set: in pathway=PWY-3101|PWY-5390|PWY-6787}}
−
{{#set: common name=tetraiodothyroacetic acid ether glucuronide}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: produced by=RXN-10616}}
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph}}

Latest revision as of 20:10, 21 March 2018

Reaction RXN-527

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-3101, flavonol biosynthesis: PWY-3101
    • 4 reactions found over 7 reactions in the full pathway
  • PWY-5390, rutin biosynthesis: PWY-5390
    • 1 reactions found over 3 reactions in the full pathway
  • PWY-6787, flavonoid biosynthesis (in equisetum): PWY-6787
    • 5 reactions found over 10 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-527&oldid=46581"