Difference between revisions of "CPD-3801"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4178 RXNQT-4178] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-isopropylmalate dehydro...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] == * smiles: ** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O * commo...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4178 RXNQT-4178] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O
 
* common name:
 
* common name:
−
** 3-isopropylmalate dehydrogenase
+
** melibionate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.1.1.85 EC-1.1.1.85]
+
** InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M
 +
* molecular weight:
 +
** 357.291   
 
* Synonym(s):
 
* Synonym(s):
 +
** melibionic acid
 +
** 6-O-α-D-galactopyranosyl-D-gluconic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-17754]]
−
** 1 [[NAD]][c] '''+''' 1 [[CPDQT-40]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPDQT-41]][c] '''+''' 1 [[NADH]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NAD+[c] '''+''' 1 3-(7'-methylthio)heptylmalate[c] '''=>''' 1 CO2[c] '''+''' 1 10-(methylthio)-2-oxodecanoate[c] '''+''' 1 NADH[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_2920]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R08646 R08646]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202771 25202771]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: common name=3-isopropylmalate dehydrogenase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75299 75299]
−
{{#set: ec number=EC-1.1.1.85}}
+
{{#set: smiles=C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O}}
−
{{#set: gene associated=Tiso_gene_2920}}
+
{{#set: common name=melibionate}}
−
{{#set: in pathway=}}
+
{{#set: inchi key=InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=357.291    }}
−
{{#set: reconstruction source=annotation-experimental_annotation}}
+
{{#set: common name=melibionic acid|6-O-α-D-galactopyranosyl-D-gluconic acid}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: consumed by=RXN-17754}}

Latest revision as of 20:11, 21 March 2018

Metabolite CPD-3801

  • smiles:
    • C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O
  • common name:
    • melibionate
  • inchi key:
    • InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M
  • molecular weight:
    • 357.291
  • Synonym(s):
    • melibionic acid
    • 6-O-α-D-galactopyranosyl-D-gluconic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-3801&oldid=46612"